C15H15BrClNOS — CID 103406160
N-[3-(3-bromopropyl)phenyl]-3-chloro-4-methylthiophene-2-carboxamide (PubChem CID 103406160) has the molecular formula C15H15BrClNOS and a molecular weight of 372.72 g/mol. Its IUPAC name is N-[3-(3-bromopropyl)phenyl]-3-chloro-4-methylthiophene-2-carboxamide.
| Compound Name | N-[3-(3-bromopropyl)phenyl]-3-chloro-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103406160 |
| Molecular Formula | C15H15BrClNOS |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | N-[3-(3-bromopropyl)phenyl]-3-chloro-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2cccc(CCCBr)c2)c1Cl |
| InChI | InChI=1S/C15H15BrClNOS/c1-10-9-20-14(13(10)17)15(19)18-12-6-2-4-11(8-12)5-3-7-16/h2,4,6,8-9H,3,5,7H2,1H3,(H,18,19) |
| InChIKey | HGFOYPPRLDPUDC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|