C13H11BrClNOS — CID 103406036
N-[3-(bromomethyl)phenyl]-3-chloro-4-methylthiophene-2-carboxamide (PubChem CID 103406036) has the molecular formula C13H11BrClNOS and a molecular weight of 344.66 g/mol. Its IUPAC name is N-[3-(bromomethyl)phenyl]-3-chloro-4-methylthiophene-2-carboxamide.
| Compound Name | N-[3-(bromomethyl)phenyl]-3-chloro-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103406036 |
| Molecular Formula | C13H11BrClNOS |
| Molecular Weight | 344.66 g/mol |
| Exact Mass | 342.94 |
| IUPAC Name | N-[3-(bromomethyl)phenyl]-3-chloro-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2cccc(CBr)c2)c1Cl |
| InChI | InChI=1S/C13H11BrClNOS/c1-8-7-18-12(11(8)15)13(17)16-10-4-2-3-9(5-10)6-14/h2-5,7H,6H2,1H3,(H,16,17) |
| InChIKey | BMWIDCVNFUEQGS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|