C12H9ClINOS — CID 103401913
3-chloro-N-(4-iodophenyl)-4-methylthiophene-2-carboxamide (PubChem CID 103401913) has the molecular formula C12H9ClINOS and a molecular weight of 377.63 g/mol. Its IUPAC name is 3-chloro-N-(4-iodophenyl)-4-methylthiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(4-iodophenyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103401913 |
| Molecular Formula | C12H9ClINOS |
| Molecular Weight | 377.63 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | 3-chloro-N-(4-iodophenyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2ccc(I)cc2)c1Cl |
| InChI | InChI=1S/C12H9ClINOS/c1-7-6-17-11(10(7)13)12(16)15-9-4-2-8(14)3-5-9/h2-6H,1H3,(H,15,16) |
| InChIKey | RGCYFNNEHXQVEQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|