C12H11ClN2O3S2 — CID 103405087
3-chloro-4-methyl-N-(2-sulfamoylphenyl)thiophene-2-carboxamide (PubChem CID 103405087) has the molecular formula C12H11ClN2O3S2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-(2-sulfamoylphenyl)thiophene-2-carboxamide.
| Compound Name | 3-chloro-4-methyl-N-(2-sulfamoylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103405087 |
| Molecular Formula | C12H11ClN2O3S2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 3-chloro-4-methyl-N-(2-sulfamoylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2ccccc2S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C12H11ClN2O3S2/c1-7-6-19-11(10(7)13)12(16)15-8-4-2-3-5-9(8)20(14,17)18/h2-6H,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | PYPHQTXTFYYRMM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |