About 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide
4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 61130905) has the molecular formula C11H11N3O3S2
and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 61130905 |
| Molecular Formula | C11H11N3O3S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)Nc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H11N3O3S2/c1-7-10(18-6-13-7)11(15)14-8-4-2-3-5-9(8)19(12,16)17/h2-6H,1H3,(H,14,15)(H2,12,16,17) |
| InChIKey | HUZPUOLUKRBLMH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide (CID 61130905) is 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide is Cc1ncsc1C(=O)Nc1ccccc1S(N)(=O)=O.
What is the InChIKey of 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide?
The InChIKey is HUZPUOLUKRBLMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3S2/c1-7-10(18-6-13-7)11(15)14-8-4-2-3-5-9(8)19(12,16)17/h2-6H,1H3,(H,14,15)(H2,12,16,17).
What are the key properties of 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide?
4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide has a molecular weight of 297.36 g/mol, XLogP of 1.35, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(2-sulfamoylphenyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 61130905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).