C11H13N3O2S2 — CID 63280801
2-[(4-methyl-1,3-thiazol-5-yl)methylamino]benzenesulfonamide (PubChem CID 63280801) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-5-yl)methylamino]benzenesulfonamide.
| Compound Name | 2-[(4-methyl-1,3-thiazol-5-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 63280801 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-5-yl)methylamino]benzenesulfonamide |
| SMILES | Cc1ncsc1CNc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C11H13N3O2S2/c1-8-10(17-7-14-8)6-13-9-4-2-3-5-11(9)18(12,15)16/h2-5,7,13H,6H2,1H3,(H2,12,15,16) |
| InChIKey | IIODRAUVULDMHT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |