C12H8BrClINOS — CID 114258897
N-(2-bromo-5-iodophenyl)-3-chloro-4-methylthiophene-2-carboxamide (PubChem CID 114258897) has the molecular formula C12H8BrClINOS and a molecular weight of 456.53 g/mol. Its IUPAC name is N-(2-bromo-5-iodophenyl)-3-chloro-4-methylthiophene-2-carboxamide.
| Compound Name | N-(2-bromo-5-iodophenyl)-3-chloro-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 114258897 |
| Molecular Formula | C12H8BrClINOS |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 454.82 |
| IUPAC Name | N-(2-bromo-5-iodophenyl)-3-chloro-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)Nc2cc(I)ccc2Br)c1Cl |
| InChI | InChI=1S/C12H8BrClINOS/c1-6-5-18-11(10(6)14)12(17)16-9-4-7(15)2-3-8(9)13/h2-5H,1H3,(H,16,17) |
| InChIKey | KNLUIFHIECTBAM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|