C14H12Br3NOS — CID 107966238
2,5-dibromo-N-[3-(3-bromopropyl)phenyl]thiophene-3-carboxamide (PubChem CID 107966238) has the molecular formula C14H12Br3NOS and a molecular weight of 482.04 g/mol. Its IUPAC name is 2,5-dibromo-N-[3-(3-bromopropyl)phenyl]thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[3-(3-bromopropyl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107966238 |
| Molecular Formula | C14H12Br3NOS |
| Molecular Weight | 482.04 g/mol |
| Exact Mass | 478.82 |
| IUPAC Name | 2,5-dibromo-N-[3-(3-bromopropyl)phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1cccc(CCCBr)c1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C14H12Br3NOS/c15-6-2-4-9-3-1-5-10(7-9)18-14(19)11-8-12(16)20-13(11)17/h1,3,5,7-8H,2,4,6H2,(H,18,19) |
| InChIKey | FCLSPMOYDPPBFK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.04 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|