C16H15BrFNO2 — CID 107016950
N-[3-(3-bromopropyl)phenyl]-4-fluoro-2-hydroxybenzamide (PubChem CID 107016950) has the molecular formula C16H15BrFNO2 and a molecular weight of 352.20 g/mol. Its IUPAC name is N-[3-(3-bromopropyl)phenyl]-4-fluoro-2-hydroxybenzamide.
| Compound Name | N-[3-(3-bromopropyl)phenyl]-4-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 107016950 |
| Molecular Formula | C16H15BrFNO2 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[3-(3-bromopropyl)phenyl]-4-fluoro-2-hydroxybenzamide |
| SMILES | O=C(Nc1cccc(CCCBr)c1)c1ccc(F)cc1O |
| InChI | InChI=1S/C16H15BrFNO2/c17-8-2-4-11-3-1-5-13(9-11)19-16(21)14-7-6-12(18)10-15(14)20/h1,3,5-7,9-10,20H,2,4,8H2,(H,19,21) |
| InChIKey | UYSXGEWNZQALNY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|