C16H16BrNO3 — CID 114345344
N-[3-(3-bromopropyl)phenyl]-2,3-dihydroxybenzamide (PubChem CID 114345344) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is N-[3-(3-bromopropyl)phenyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[3-(3-bromopropyl)phenyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114345344 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[3-(3-bromopropyl)phenyl]-2,3-dihydroxybenzamide |
| SMILES | O=C(Nc1cccc(CCCBr)c1)c1cccc(O)c1O |
| InChI | InChI=1S/C16H16BrNO3/c17-9-3-5-11-4-1-6-12(10-11)18-16(21)13-7-2-8-14(19)15(13)20/h1-2,4,6-8,10,19-20H,3,5,9H2,(H,18,21) |
| InChIKey | KCDYONORTKZWFE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|