C14H13ClN2OS2 — CID 103404202
N-[[5-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-3-chloro-4-methylthiophene-2-carboxamide (PubChem CID 103404202) has the molecular formula C14H13ClN2OS2 and a molecular weight of 324.86 g/mol. Its IUPAC name is N-[[5-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-3-chloro-4-methylthiophene-2-carboxamide.
| Compound Name | N-[[5-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-3-chloro-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103404202 |
| Molecular Formula | C14H13ClN2OS2 |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-[[5-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-3-chloro-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)NCc2ccc(C#CCN)s2)c1Cl |
| InChI | InChI=1S/C14H13ClN2OS2/c1-9-8-19-13(12(9)15)14(18)17-7-11-5-4-10(20-11)3-2-6-16/h4-5,8H,6-7,16H2,1H3,(H,17,18) |
| InChIKey | WRXSQKVDBQLACZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|