C9H7BrN2OS2 — CID 104579028
5-bromo-N-(1,3-thiazol-5-ylmethyl)thiophene-2-carboxamide (PubChem CID 104579028) has the molecular formula C9H7BrN2OS2 and a molecular weight of 303.21 g/mol. Its IUPAC name is 5-bromo-N-(1,3-thiazol-5-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(1,3-thiazol-5-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 104579028 |
| Molecular Formula | C9H7BrN2OS2 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 301.92 |
| IUPAC Name | 5-bromo-N-(1,3-thiazol-5-ylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCc1cncs1)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H7BrN2OS2/c10-8-2-1-7(15-8)9(13)12-4-6-3-11-5-14-6/h1-3,5H,4H2,(H,12,13) |
| InChIKey | SPROERBMPKHBTR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |