C6H8N2O2S — CID 130927920
2-hydroxy-N-(1,3-thiazol-5-ylmethyl)acetamide (PubChem CID 130927920) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-hydroxy-N-(1,3-thiazol-5-ylmethyl)acetamide.
| Compound Name | 2-hydroxy-N-(1,3-thiazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 130927920 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 2-hydroxy-N-(1,3-thiazol-5-ylmethyl)acetamide |
| SMILES | O=C(CO)NCc1cncs1 |
| InChI | InChI=1S/C6H8N2O2S/c9-3-6(10)8-2-5-1-7-4-11-5/h1,4,9H,2-3H2,(H,8,10) |
| InChIKey | LYWRWZXSOQDCPF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |