C7H10F2N2OS — CID 103793274
1,1-difluoro-3-(1,3-thiazol-5-ylmethylamino)propan-2-ol (PubChem CID 103793274) has the molecular formula C7H10F2N2OS and a molecular weight of 208.23 g/mol. Its IUPAC name is 1,1-difluoro-3-(1,3-thiazol-5-ylmethylamino)propan-2-ol.
| Compound Name | 1,1-difluoro-3-(1,3-thiazol-5-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 103793274 |
| Molecular Formula | C7H10F2N2OS |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1,1-difluoro-3-(1,3-thiazol-5-ylmethylamino)propan-2-ol |
| SMILES | OC(CNCc1cncs1)C(F)F |
| InChI | InChI=1S/C7H10F2N2OS/c8-7(9)6(12)3-10-1-5-2-11-4-13-5/h2,4,6-7,10,12H,1,3H2 |
| InChIKey | ILROSAWWAQTSQE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |