C11H10N2O3S — CID 104583444
3,5-dihydroxy-N-(1,3-thiazol-5-ylmethyl)benzamide (PubChem CID 104583444) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 3,5-dihydroxy-N-(1,3-thiazol-5-ylmethyl)benzamide.
| Compound Name | 3,5-dihydroxy-N-(1,3-thiazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 104583444 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 3,5-dihydroxy-N-(1,3-thiazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1cncs1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H10N2O3S/c14-8-1-7(2-9(15)3-8)11(16)13-5-10-4-12-6-17-10/h1-4,6,14-15H,5H2,(H,13,16) |
| InChIKey | ZGICEQUFTSDXIZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |