C9H7IN2OS2 — CID 104579050
5-iodo-N-(1,3-thiazol-5-ylmethyl)thiophene-3-carboxamide (PubChem CID 104579050) has the molecular formula C9H7IN2OS2 and a molecular weight of 350.21 g/mol. Its IUPAC name is 5-iodo-N-(1,3-thiazol-5-ylmethyl)thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-(1,3-thiazol-5-ylmethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 104579050 |
| Molecular Formula | C9H7IN2OS2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.90 |
| IUPAC Name | 5-iodo-N-(1,3-thiazol-5-ylmethyl)thiophene-3-carboxamide |
| SMILES | O=C(NCc1cncs1)c1csc(I)c1 |
| InChI | InChI=1S/C9H7IN2OS2/c10-8-1-6(4-14-8)9(13)12-3-7-2-11-5-15-7/h1-2,4-5H,3H2,(H,12,13) |
| InChIKey | HPQRWDWRRMIIMI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|