C7H9IN2O3S2 — CID 78950626
5-iodo-N-(2-sulfamoylethyl)thiophene-3-carboxamide (PubChem CID 78950626) has the molecular formula C7H9IN2O3S2 and a molecular weight of 360.20 g/mol. Its IUPAC name is 5-iodo-N-(2-sulfamoylethyl)thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-(2-sulfamoylethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78950626 |
| Molecular Formula | C7H9IN2O3S2 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.91 |
| IUPAC Name | 5-iodo-N-(2-sulfamoylethyl)thiophene-3-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C7H9IN2O3S2/c8-6-3-5(4-14-6)7(11)10-1-2-15(9,12)13/h3-4H,1-2H2,(H,10,11)(H2,9,12,13) |
| InChIKey | KVXDMJOTGYDDOU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|