C9H11IN2O2S — CID 78949941
5-iodo-N-[3-(methylamino)-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 78949941) has the molecular formula C9H11IN2O2S and a molecular weight of 338.17 g/mol. Its IUPAC name is 5-iodo-N-[3-(methylamino)-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[3-(methylamino)-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78949941 |
| Molecular Formula | C9H11IN2O2S |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 5-iodo-N-[3-(methylamino)-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | CNC(=O)CCNC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C9H11IN2O2S/c1-11-8(13)2-3-12-9(14)6-4-7(10)15-5-6/h4-5H,2-3H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | JTYBLWAEFQNKIB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|