C12H9BrClNOS2 — CID 107030591
4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-2-sulfanylbenzamide (PubChem CID 107030591) has the molecular formula C12H9BrClNOS2 and a molecular weight of 362.70 g/mol. Its IUPAC name is 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107030591 |
| Molecular Formula | C12H9BrClNOS2 |
| Molecular Weight | 362.70 g/mol |
| Exact Mass | 360.90 |
| IUPAC Name | 4-bromo-N-[(5-chlorothiophen-2-yl)methyl]-2-sulfanylbenzamide |
| SMILES | O=C(NCc1ccc(Cl)s1)c1ccc(Br)cc1S |
| InChI | InChI=1S/C12H9BrClNOS2/c13-7-1-3-9(10(17)5-7)12(16)15-6-8-2-4-11(14)18-8/h1-5,17H,6H2,(H,15,16) |
| InChIKey | ZBCKJIXZWPKYLE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.70 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|