C13H10Br2ClNOS — CID 103882523
2,4-dibromo-N-[2-(5-chlorothiophen-2-yl)ethyl]benzamide (PubChem CID 103882523) has the molecular formula C13H10Br2ClNOS and a molecular weight of 423.56 g/mol. Its IUPAC name is 2,4-dibromo-N-[2-(5-chlorothiophen-2-yl)ethyl]benzamide.
| Compound Name | 2,4-dibromo-N-[2-(5-chlorothiophen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 103882523 |
| Molecular Formula | C13H10Br2ClNOS |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 420.85 |
| IUPAC Name | 2,4-dibromo-N-[2-(5-chlorothiophen-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(Cl)s1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H10Br2ClNOS/c14-8-1-3-10(11(15)7-8)13(18)17-6-5-9-2-4-12(16)19-9/h1-4,7H,5-6H2,(H,17,18) |
| InChIKey | MNBXGMPQLNMERC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |