C14H14ClNO2S — CID 103863673
N-[2-(5-chlorothiophen-2-yl)ethyl]-4-hydroxy-2-methylbenzamide (PubChem CID 103863673) has the molecular formula C14H14ClNO2S and a molecular weight of 295.79 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-4-hydroxy-2-methylbenzamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-4-hydroxy-2-methylbenzamide |
|---|---|
| PubChem CID | 103863673 |
| Molecular Formula | C14H14ClNO2S |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-4-hydroxy-2-methylbenzamide |
| SMILES | Cc1cc(O)ccc1C(=O)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H14ClNO2S/c1-9-8-10(17)2-4-12(9)14(18)16-7-6-11-3-5-13(15)19-11/h2-5,8,17H,6-7H2,1H3,(H,16,18) |
| InChIKey | ROSJBRCALAROFD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |