C13H13BrN2O2S — CID 106377769
4-bromo-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-sulfanylbenzamide (PubChem CID 106377769) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is 4-bromo-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 106377769 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 4-bromo-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-sulfanylbenzamide |
| SMILES | Cc1nc(CNC(=O)c2ccc(Br)cc2S)oc1C |
| InChI | InChI=1S/C13H13BrN2O2S/c1-7-8(2)18-12(16-7)6-15-13(17)10-4-3-9(14)5-11(10)19/h3-5,19H,6H2,1-2H3,(H,15,17) |
| InChIKey | PXDGUNQZHOAXJV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|