C12H10ClNO3S — CID 114344423
N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxybenzamide (PubChem CID 114344423) has the molecular formula C12H10ClNO3S and a molecular weight of 283.74 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114344423 |
| Molecular Formula | C12H10ClNO3S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxybenzamide |
| SMILES | O=C(NCc1ccc(Cl)s1)c1cccc(O)c1O |
| InChI | InChI=1S/C12H10ClNO3S/c13-10-5-4-7(18-10)6-14-12(17)8-2-1-3-9(15)11(8)16/h1-5,15-16H,6H2,(H,14,17) |
| InChIKey | RZVOHGGIRBYMDJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|