C13H12ClNO3S — CID 114344048
N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxy-N-methylbenzamide (PubChem CID 114344048) has the molecular formula C13H12ClNO3S and a molecular weight of 297.76 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxy-N-methylbenzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 114344048 |
| Molecular Formula | C13H12ClNO3S |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxy-N-methylbenzamide |
| SMILES | CN(Cc1ccc(Cl)s1)C(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C13H12ClNO3S/c1-15(7-8-5-6-11(14)19-8)13(18)9-3-2-4-10(16)12(9)17/h2-6,16-17H,7H2,1H3 |
| InChIKey | WLPCHSWYEDVBMW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|