C11H9ClN2O2S — CID 107261709
N-[(5-chlorothiophen-2-yl)methyl]-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 107261709) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107261709 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)s1)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C11H9ClN2O2S/c12-9-5-4-7(17-9)6-13-11(16)8-2-1-3-10(15)14-8/h1-5H,6H2,(H,13,16)(H,14,15) |
| InChIKey | VYUJGLBVIQQFEC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |