C13H11Br2NOS — CID 107980409
3,5-dibromo-N-[(5-methylthiophen-2-yl)methyl]benzamide (PubChem CID 107980409) has the molecular formula C13H11Br2NOS and a molecular weight of 389.11 g/mol. Its IUPAC name is 3,5-dibromo-N-[(5-methylthiophen-2-yl)methyl]benzamide.
| Compound Name | 3,5-dibromo-N-[(5-methylthiophen-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 107980409 |
| Molecular Formula | C13H11Br2NOS |
| Molecular Weight | 389.11 g/mol |
| Exact Mass | 386.89 |
| IUPAC Name | 3,5-dibromo-N-[(5-methylthiophen-2-yl)methyl]benzamide |
| SMILES | Cc1ccc(CNC(=O)c2cc(Br)cc(Br)c2)s1 |
| InChI | InChI=1S/C13H11Br2NOS/c1-8-2-3-12(18-8)7-16-13(17)9-4-10(14)6-11(15)5-9/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | ZEDOEHSTGUXKTD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.11 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |