C14H12N2O4S — CID 106383266
(E)-3-[3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]phenyl]prop-2-enoic acid (PubChem CID 106383266) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is (E)-3-[3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106383266 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | (E)-3-[3-[(2-oxo-3H-1,3-thiazol-4-yl)methylcarbamoyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(C(=O)NCc2csc(=O)[nH]2)c1 |
| InChI | InChI=1S/C14H12N2O4S/c17-12(18)5-4-9-2-1-3-10(6-9)13(19)15-7-11-8-21-14(20)16-11/h1-6,8H,7H2,(H,15,19)(H,16,20)(H,17,18)/b5-4+ |
| InChIKey | OBIMWNKUAYRVGH-SNAWJCMRSA-N |
| XLogP | 1.46 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|