C11H9ClN2O3S — CID 103862828
3-chloro-4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 103862828) has the molecular formula C11H9ClN2O3S and a molecular weight of 284.72 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 103862828 |
| Molecular Formula | C11H9ClN2O3S |
| Molecular Weight | 284.72 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1csc(=O)[nH]1)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C11H9ClN2O3S/c12-8-3-6(1-2-9(8)15)10(16)13-4-7-5-18-11(17)14-7/h1-3,5,15H,4H2,(H,13,16)(H,14,17) |
| InChIKey | RVEMJFUNSXAUCX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |