C12H13N3O2S — CID 106383401
4-(methylamino)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 106383401) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 4-(methylamino)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 4-(methylamino)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 106383401 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-(methylamino)-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | CNc1ccc(C(=O)NCc2csc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C12H13N3O2S/c1-13-9-4-2-8(3-5-9)11(16)14-6-10-7-18-12(17)15-10/h2-5,7,13H,6H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | ZLNCVKOFIXYVGI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |