C12H11N3O2S2 — CID 106381453
3-carbamothioyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide (PubChem CID 106381453) has the molecular formula C12H11N3O2S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-carbamothioyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide.
| Compound Name | 3-carbamothioyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 106381453 |
| Molecular Formula | C12H11N3O2S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 3-carbamothioyl-N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]benzamide |
| SMILES | NC(=S)c1cccc(C(=O)NCc2csc(=O)[nH]2)c1 |
| InChI | InChI=1S/C12H11N3O2S2/c13-10(18)7-2-1-3-8(4-7)11(16)14-5-9-6-19-12(17)15-9/h1-4,6H,5H2,(H2,13,18)(H,14,16)(H,15,17) |
| InChIKey | USVXKDJHHKHBSW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|