C11H11N3OS2 — CID 106381505
4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide (PubChem CID 106381505) has the molecular formula C11H11N3OS2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide.
| Compound Name | 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 106381505 |
| Molecular Formula | C11H11N3OS2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCc2csc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C11H11N3OS2/c12-10(16)7-1-3-8(4-2-7)13-5-9-6-17-11(15)14-9/h1-4,6,13H,5H2,(H2,12,16)(H,14,15) |
| InChIKey | DTWJZJPEEOGFEB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|