C9H11N5OS — CID 106384321
4-[[(2-hydrazinyl-4-pyridinyl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106384321) has the molecular formula C9H11N5OS and a molecular weight of 237.29 g/mol. Its IUPAC name is 4-[[(2-hydrazinyl-4-pyridinyl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(2-hydrazinyl-4-pyridinyl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106384321 |
| Molecular Formula | C9H11N5OS |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-[[(2-hydrazinyl-4-pyridinyl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | NNc1cc(NCc2csc(=O)[nH]2)ccn1 |
| InChI | InChI=1S/C9H11N5OS/c10-14-8-3-6(1-2-11-8)12-4-7-5-16-9(15)13-7/h1-3,5H,4,10H2,(H,13,15)(H2,11,12,14) |
| InChIKey | BENJOXUVLFFPOW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|