C11H9N3O2S — CID 114181566
4-[(furo[3,2-c]pyridin-4-ylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 114181566) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 4-[(furo[3,2-c]pyridin-4-ylamino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(furo[3,2-c]pyridin-4-ylamino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 114181566 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 4-[(furo[3,2-c]pyridin-4-ylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNc2nccc3occc23)cs1 |
| InChI | InChI=1S/C11H9N3O2S/c15-11-14-7(6-17-11)5-13-10-8-2-4-16-9(8)1-3-12-10/h1-4,6H,5H2,(H,12,13)(H,14,15) |
| InChIKey | VJUMCVCFSNVSBH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |