C12H13N3O4S — CID 106381995
4-[(3-ethoxy-4-nitroanilino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381995) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-[(3-ethoxy-4-nitroanilino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(3-ethoxy-4-nitroanilino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381995 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 4-[(3-ethoxy-4-nitroanilino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | CCOc1cc(NCc2csc(=O)[nH]2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O4S/c1-2-19-11-5-8(3-4-10(11)15(17)18)13-6-9-7-20-12(16)14-9/h3-5,7,13H,2,6H2,1H3,(H,14,16) |
| InChIKey | VIVDIMUSCIWOSX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|