C10H9N3O3S — CID 103775093
4-[(2-nitroanilino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 103775093) has the molecular formula C10H9N3O3S and a molecular weight of 251.27 g/mol. Its IUPAC name is 4-[(2-nitroanilino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(2-nitroanilino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 103775093 |
| Molecular Formula | C10H9N3O3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 4-[(2-nitroanilino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNc2ccccc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C10H9N3O3S/c14-10-12-7(6-17-10)5-11-8-3-1-2-4-9(8)13(15)16/h1-4,6,11H,5H2,(H,12,14) |
| InChIKey | BHNCAYVKKRDRFC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|