C10H7N5O3S — CID 106382248
3-nitro-6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-2-carbonitrile (PubChem CID 106382248) has the molecular formula C10H7N5O3S and a molecular weight of 277.27 g/mol. Its IUPAC name is 3-nitro-6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-2-carbonitrile.
| Compound Name | 3-nitro-6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 106382248 |
| Molecular Formula | C10H7N5O3S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 3-nitro-6-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-2-carbonitrile |
| SMILES | N#Cc1nc(NCc2csc(=O)[nH]2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7N5O3S/c11-3-7-8(15(17)18)1-2-9(14-7)12-4-6-5-19-10(16)13-6/h1-2,5H,4H2,(H,12,14)(H,13,16) |
| InChIKey | ZWAKJCOEVWOEBE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|