C13H10N4O3S — CID 106381959
4-[[(5-nitroisoquinolin-8-yl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106381959) has the molecular formula C13H10N4O3S and a molecular weight of 302.31 g/mol. Its IUPAC name is 4-[[(5-nitroisoquinolin-8-yl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(5-nitroisoquinolin-8-yl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106381959 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-[[(5-nitroisoquinolin-8-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNc2ccc([N+](=O)[O-])c3ccncc23)cs1 |
| InChI | InChI=1S/C13H10N4O3S/c18-13-16-8(7-21-13)5-15-11-1-2-12(17(19)20)9-3-4-14-6-10(9)11/h1-4,6-7,15H,5H2,(H,16,18) |
| InChIKey | WXTCATAAJIIVCA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|