C11H8F3N3O3S — CID 103775092
4-[[2-nitro-4-(trifluoromethyl)anilino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 103775092) has the molecular formula C11H8F3N3O3S and a molecular weight of 319.26 g/mol. Its IUPAC name is 4-[[2-nitro-4-(trifluoromethyl)anilino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[2-nitro-4-(trifluoromethyl)anilino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 103775092 |
| Molecular Formula | C11H8F3N3O3S |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-[[2-nitro-4-(trifluoromethyl)anilino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C11H8F3N3O3S/c12-11(13,14)6-1-2-8(9(3-6)17(19)20)15-4-7-5-21-10(18)16-7/h1-3,5,15H,4H2,(H,16,18) |
| InChIKey | KABMDCNMEOSVSC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|