C12H13N3O5S — CID 106382074
4-[(4,5-dimethoxy-2-nitroanilino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106382074) has the molecular formula C12H13N3O5S and a molecular weight of 311.32 g/mol. Its IUPAC name is 4-[(4,5-dimethoxy-2-nitroanilino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(4,5-dimethoxy-2-nitroanilino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106382074 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-[(4,5-dimethoxy-2-nitroanilino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | COc1cc(NCc2csc(=O)[nH]2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C12H13N3O5S/c1-19-10-3-8(9(15(17)18)4-11(10)20-2)13-5-7-6-21-12(16)14-7/h3-4,6,13H,5H2,1-2H3,(H,14,16) |
| InChIKey | QBJSNHDSLKXKSS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|