C12H12N4O4S — CID 103775110
N-methyl-3-nitro-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide (PubChem CID 103775110) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is N-methyl-3-nitro-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide.
| Compound Name | N-methyl-3-nitro-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 103775110 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | N-methyl-3-nitro-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide |
| SMILES | CNC(=O)c1ccc(NCc2csc(=O)[nH]2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N4O4S/c1-13-11(17)7-2-3-9(10(4-7)16(19)20)14-5-8-6-21-12(18)15-8/h2-4,6,14H,5H2,1H3,(H,13,17)(H,15,18) |
| InChIKey | DCYWEQJVIFZONT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 117.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|