C12H14N4O2S — CID 106379388
3-amino-N-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide (PubChem CID 106379388) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 3-amino-N-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide.
| Compound Name | 3-amino-N-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 106379388 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-amino-N-methyl-4-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzamide |
| SMILES | CNC(=O)c1ccc(NCc2csc(=O)[nH]2)c(N)c1 |
| InChI | InChI=1S/C12H14N4O2S/c1-14-11(17)7-2-3-10(9(13)4-7)15-5-8-6-19-12(18)16-8/h2-4,6,15H,5,13H2,1H3,(H,14,17)(H,16,18) |
| InChIKey | FBELSSWELDRQQU-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|