C11H13N3OS — CID 106379468
4-[(4-amino-2-methylanilino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379468) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-[(4-amino-2-methylanilino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(4-amino-2-methylanilino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106379468 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-[(4-amino-2-methylanilino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | Cc1cc(N)ccc1NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C11H13N3OS/c1-7-4-8(12)2-3-10(7)13-5-9-6-16-11(15)14-9/h2-4,6,13H,5,12H2,1H3,(H,14,15) |
| InChIKey | VRYWSEGHKPWQCX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|