C11H10N4OS2 — CID 106379387
4-[[(6-amino-1,3-benzothiazol-2-yl)amino]methyl]-3H-1,3-thiazol-2-one (PubChem CID 106379387) has the molecular formula C11H10N4OS2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-[[(6-amino-1,3-benzothiazol-2-yl)amino]methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[[(6-amino-1,3-benzothiazol-2-yl)amino]methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106379387 |
| Molecular Formula | C11H10N4OS2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 4-[[(6-amino-1,3-benzothiazol-2-yl)amino]methyl]-3H-1,3-thiazol-2-one |
| SMILES | Nc1ccc2nc(NCc3csc(=O)[nH]3)sc2c1 |
| InChI | InChI=1S/C11H10N4OS2/c12-6-1-2-8-9(3-6)18-10(15-8)13-4-7-5-17-11(16)14-7/h1-3,5H,4,12H2,(H,13,15)(H,14,16) |
| InChIKey | HUOQPNFIGMZTMI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|