C11H10FN3O3S — CID 114181768
2-amino-4-fluoro-5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzoic acid (PubChem CID 114181768) has the molecular formula C11H10FN3O3S and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-amino-4-fluoro-5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzoic acid.
| Compound Name | 2-amino-4-fluoro-5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 114181768 |
| Molecular Formula | C11H10FN3O3S |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-amino-4-fluoro-5-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]benzoic acid |
| SMILES | Nc1cc(F)c(NCc2csc(=O)[nH]2)cc1C(=O)O |
| InChI | InChI=1S/C11H10FN3O3S/c12-7-2-8(13)6(10(16)17)1-9(7)14-3-5-4-19-11(18)15-5/h1-2,4,14H,3,13H2,(H,15,18)(H,16,17) |
| InChIKey | OMCAMLGFUHLNSZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|