C10H9F2N3OS — CID 114181202
4-[(2-amino-3,5-difluoroanilino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 114181202) has the molecular formula C10H9F2N3OS and a molecular weight of 257.26 g/mol. Its IUPAC name is 4-[(2-amino-3,5-difluoroanilino)methyl]-3H-1,3-thiazol-2-one.
| Compound Name | 4-[(2-amino-3,5-difluoroanilino)methyl]-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 114181202 |
| Molecular Formula | C10H9F2N3OS |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 4-[(2-amino-3,5-difluoroanilino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | Nc1c(F)cc(F)cc1NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C10H9F2N3OS/c11-5-1-7(12)9(13)8(2-5)14-3-6-4-17-10(16)15-6/h1-2,4,14H,3,13H2,(H,15,16) |
| InChIKey | NKXISSZJPNMZJL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|