C11H10F2N2S — CID 115506987
3,5-difluoro-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine (PubChem CID 115506987) has the molecular formula C11H10F2N2S and a molecular weight of 240.28 g/mol. Its IUPAC name is 3,5-difluoro-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine.
| Compound Name | 3,5-difluoro-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115506987 |
| Molecular Formula | C11H10F2N2S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 3,5-difluoro-1-N-(thiophen-3-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1c(F)cc(F)cc1NCc1ccsc1 |
| InChI | InChI=1S/C11H10F2N2S/c12-8-3-9(13)11(14)10(4-8)15-5-7-1-2-16-6-7/h1-4,6,15H,5,14H2 |
| InChIKey | OCUGGMNVSCQKJC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|