C12H12F2N2S — CID 115506741
3,5-difluoro-1-N-(2-thiophen-3-ylethyl)benzene-1,2-diamine (PubChem CID 115506741) has the molecular formula C12H12F2N2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 3,5-difluoro-1-N-(2-thiophen-3-ylethyl)benzene-1,2-diamine.
| Compound Name | 3,5-difluoro-1-N-(2-thiophen-3-ylethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115506741 |
| Molecular Formula | C12H12F2N2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3,5-difluoro-1-N-(2-thiophen-3-ylethyl)benzene-1,2-diamine |
| SMILES | Nc1c(F)cc(F)cc1NCCc1ccsc1 |
| InChI | InChI=1S/C12H12F2N2S/c13-9-5-10(14)12(15)11(6-9)16-3-1-8-2-4-17-7-8/h2,4-7,16H,1,3,15H2 |
| InChIKey | AQMZTDQLNBVWKN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|