C10H8F2N2S — CID 115507118
3,5-difluoro-1-N-thiophen-3-ylbenzene-1,2-diamine (PubChem CID 115507118) has the molecular formula C10H8F2N2S and a molecular weight of 226.25 g/mol. Its IUPAC name is 3,5-difluoro-1-N-thiophen-3-ylbenzene-1,2-diamine.
| Compound Name | 3,5-difluoro-1-N-thiophen-3-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115507118 |
| Molecular Formula | C10H8F2N2S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 3,5-difluoro-1-N-thiophen-3-ylbenzene-1,2-diamine |
| SMILES | Nc1c(F)cc(F)cc1Nc1ccsc1 |
| InChI | InChI=1S/C10H8F2N2S/c11-6-3-8(12)10(13)9(4-6)14-7-1-2-15-5-7/h1-5,14H,13H2 |
| InChIKey | XKBBXVAXSVOMLW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|