C13H15N3OS — CID 61475711
5-amino-2-(2-thiophen-3-ylethylamino)benzamide (PubChem CID 61475711) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 5-amino-2-(2-thiophen-3-ylethylamino)benzamide.
| Compound Name | 5-amino-2-(2-thiophen-3-ylethylamino)benzamide |
|---|---|
| PubChem CID | 61475711 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 5-amino-2-(2-thiophen-3-ylethylamino)benzamide |
| SMILES | NC(=O)c1cc(N)ccc1NCCc1ccsc1 |
| InChI | InChI=1S/C13H15N3OS/c14-10-1-2-12(11(7-10)13(15)17)16-5-3-9-4-6-18-8-9/h1-2,4,6-8,16H,3,5,14H2,(H2,15,17) |
| InChIKey | ZYTVXPFPMZXBMN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|