C12H13N3OS — CID 63244338
5-amino-2-(thiophen-3-ylmethylamino)benzamide (PubChem CID 63244338) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 5-amino-2-(thiophen-3-ylmethylamino)benzamide.
| Compound Name | 5-amino-2-(thiophen-3-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 63244338 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 5-amino-2-(thiophen-3-ylmethylamino)benzamide |
| SMILES | NC(=O)c1cc(N)ccc1NCc1ccsc1 |
| InChI | InChI=1S/C12H13N3OS/c13-9-1-2-11(10(5-9)12(14)16)15-6-8-3-4-17-7-8/h1-5,7,15H,6,13H2,(H2,14,16) |
| InChIKey | KQFIPQLEECJGNJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|